Home
Products
5-Hydroxytryptophan
| Product Name | 5-Hydroxytryptophan |
| Price: | $15 / 20mg |
| Catalog No.: | CN02160 |
| CAS No.: | 56-69-9 |
| Molecular Formula: | C11H12N2O3 |
| Molecular Weight: | 220.23 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | White powder |
| Source: | The seeds of Griffonia simplicifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)[C@H](Cc1c[nH]c2c1cc(O)cc2)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5-Hydroxytryptophan, a tryptophan metabolite, is a direct 5-hydroxytryptamine (5-HT) precursor and an L-aromatic amino acid decarboxylase substrate. [1][2][3]. |
| Target | Human Endogenous Metabolite |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 520.6±50.0 °C at 760 mmHg |
| Flash Point | 268.7±30.1 °C |
| Exact Mass | 220.084793 |
| PSA | 99.34000 |
| LogP | -0.14 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Storage condition | 2-8°C |